C31H29N3O4S — CID 102288372
(4aR,6S,7R,8R,8aR)-7-azido-6-(4-methylphenyl)sulfanyl-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102288372) has the molecular formula C31H29N3O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-7-azido-6-(4-methylphenyl)sulfanyl-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8R,8aR)-7-azido-6-(4-methylphenyl)sulfanyl-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102288372 |
| Molecular Formula | C31H29N3O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-7-azido-6-(4-methylphenyl)sulfanyl-8-(naphthalen-2-ylmethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H]3COC(c4ccccc4)O[C@@H]3[C@H](OCc3ccc4ccccc4c3)[C@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C31H29N3O4S/c1-20-11-15-25(16-12-20)39-31-27(33-34-32)29(35-18-21-13-14-22-7-5-6-10-24(22)17-21)28-26(37-31)19-36-30(38-28)23-8-3-2-4-9-23/h2-17,26-31H,18-19H2,1H3/t26-,27-,28+,29-,30?,31+/m1/s1 |
| InChIKey | OOFNJVDJZYAMKD-HMQNZOLESA-N |
| XLogP | 7.34 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|