C28H34O8S — CID 101174022
[(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-oxopentanoate (PubChem CID 101174022) has the molecular formula C28H34O8S and a molecular weight of 530.64 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-oxopentanoate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 101174022 |
| Molecular Formula | C28H34O8S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-oxopentanoate |
| SMILES | CCS[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OCc2ccc(OC)cc2)[C@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C28H34O8S/c1-4-37-28-26(35-23(30)15-10-18(2)29)25(32-16-19-11-13-21(31-3)14-12-19)24-22(34-28)17-33-27(36-24)20-8-6-5-7-9-20/h5-9,11-14,22,24-28H,4,10,15-17H2,1-3H3/t22-,24+,25+,26-,27?,28+/m1/s1 |
| InChIKey | AGRKDTYMTZTIHL-OHFOHWEQSA-N |
| XLogP | 4.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |