C33H36O7S — CID 11157445
[(2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-(2-prop-2-enoxyphenyl)acetate (PubChem CID 11157445) has the molecular formula C33H36O7S and a molecular weight of 576.71 g/mol. Its IUPAC name is [(2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-(2-prop-2-enoxyphenyl)acetate.
| Compound Name | [(2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-(2-prop-2-enoxyphenyl)acetate |
|---|---|
| PubChem CID | 11157445 |
| Molecular Formula | C33H36O7S |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | [(2S,4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-(2-prop-2-enoxyphenyl)acetate |
| SMILES | C=CCOc1ccccc1CC(=O)O[C@@H]1[C@@H](OCc2ccccc2)[C@H]2O[C@@H](c3ccccc3)OC[C@H]2O[C@H]1SCC |
| InChI | InChI=1S/C33H36O7S/c1-3-19-35-26-18-12-11-17-25(26)20-28(34)39-31-30(36-21-23-13-7-5-8-14-23)29-27(38-33(31)41-4-2)22-37-32(40-29)24-15-9-6-10-16-24/h3,5-18,27,29-33H,1,4,19-22H2,2H3/t27-,29+,30+,31-,32+,33+/m1/s1 |
| InChIKey | PEVOYLRTRVWXQO-QBCZUQCBSA-N |
| XLogP | 5.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|