C29H29NO8S — CID 11028043
[(2R,4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate (PubChem CID 11028043) has the molecular formula C29H29NO8S and a molecular weight of 551.62 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11028043 |
| Molecular Formula | C29H29NO8S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate |
| SMILES | CCS[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H29NO8S/c1-2-39-29-26(37-27(31)20-13-15-22(16-14-20)30(32)33)25(34-17-19-9-5-3-6-10-19)24-23(36-29)18-35-28(38-24)21-11-7-4-8-12-21/h3-16,23-26,28-29H,2,17-18H2,1H3/t23-,24-,25+,26-,28-,29+/m1/s1 |
| InChIKey | NVXMPZDQPAKLTI-PCEUIPHGSA-N |
| XLogP | 5.30 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|