C33H32O6S — CID 11387360
[(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-(2-methylnaphthalen-1-yl)oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 11387360) has the molecular formula C33H32O6S and a molecular weight of 556.68 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-(2-methylnaphthalen-1-yl)oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-(2-methylnaphthalen-1-yl)oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 11387360 |
| Molecular Formula | C33H32O6S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-6-ethylsulfanyl-8-(2-methylnaphthalen-1-yl)oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CCS[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](Oc2c(C)ccc3ccccc23)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32O6S/c1-3-40-33-30(38-31(34)23-13-6-4-7-14-23)29(37-27-21(2)18-19-22-12-10-11-17-25(22)27)28-26(36-33)20-35-32(39-28)24-15-8-5-9-16-24/h4-19,26,28-30,32-33H,3,20H2,1-2H3/t26-,28+,29+,30-,32?,33+/m1/s1 |
| InChIKey | VGWQFSUPVDTQKQ-NGWRJAJHSA-N |
| XLogP | 6.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |