C32H44O10 — CID 118232738
[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 3,4,5-tributoxybenzoate (PubChem CID 118232738) has the molecular formula C32H44O10 and a molecular weight of 588.69 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 3,4,5-tributoxybenzoate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 3,4,5-tributoxybenzoate |
|---|---|
| PubChem CID | 118232738 |
| Molecular Formula | C32H44O10 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 3,4,5-tributoxybenzoate |
| SMILES | CCCCOc1cc(C(=O)O[C@@H]2O[C@@H]3COC(c4ccccc4)O[C@H]3[C@H](O)[C@H]2O)cc(OCCCC)c1OCCCC |
| InChI | InChI=1S/C32H44O10/c1-4-7-15-36-23-18-22(19-24(37-16-8-5-2)28(23)38-17-9-6-3)30(35)42-32-27(34)26(33)29-25(40-32)20-39-31(41-29)21-13-11-10-12-14-21/h10-14,18-19,25-27,29,31-34H,4-9,15-17,20H2,1-3H3/t25-,26-,27-,29-,31?,32+/m1/s1 |
| InChIKey | XZAAOHHYMDGEKO-MNYDMALGSA-N |
| XLogP | 4.94 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|