C22H24O7 — CID 59501799
[(2R,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-methylbenzoate (PubChem CID 59501799) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-methylbenzoate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 59501799 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H]2O[C@@H]3CO[C@@H](c4ccc(C)cc4)O[C@H]3[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H24O7/c1-12-3-7-14(8-4-12)20(25)29-22-18(24)17(23)19-16(27-22)11-26-21(28-19)15-9-5-13(2)6-10-15/h3-10,16-19,21-24H,11H2,1-2H3/t16-,17-,18-,19-,21-,22+/m1/s1 |
| InChIKey | KGEFEONODSLCPH-ZQMBKUMFSA-N |
| XLogP | 2.02 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |