C40H52O10 — CID 102095162
[4-[(4aR,6S,7R,8R,8aS)-6-(4-hexoxyphenoxy)-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]phenyl] 4-octoxybenzoate (PubChem CID 102095162) has the molecular formula C40H52O10 and a molecular weight of 692.85 g/mol. Its IUPAC name is [4-[(4aR,6S,7R,8R,8aS)-6-(4-hexoxyphenoxy)-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[(4aR,6S,7R,8R,8aS)-6-(4-hexoxyphenoxy)-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 102095162 |
| Molecular Formula | C40H52O10 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | [4-[(4aR,6S,7R,8R,8aS)-6-(4-hexoxyphenoxy)-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C3OC[C@H]4O[C@@H](Oc5ccc(OCCCCCC)cc5)[C@H](O)[C@@H](O)[C@@H]4O3)cc2)cc1 |
| InChI | InChI=1S/C40H52O10/c1-3-5-7-9-10-12-26-44-30-17-13-28(14-18-30)38(43)47-32-19-15-29(16-20-32)39-46-27-34-37(50-39)35(41)36(42)40(49-34)48-33-23-21-31(22-24-33)45-25-11-8-6-4-2/h13-24,34-37,39-42H,3-12,25-27H2,1-2H3/t34-,35-,36-,37-,39?,40-/m1/s1 |
| InChIKey | YCJRFMJBQYPDQX-QXOPEZQSSA-N |
| XLogP | 7.54 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|