C19H27NO6 — CID 162774485
N-[(6S,8aS)-6-butoxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 162774485) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(6S,8aS)-6-butoxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(6S,8aS)-6-butoxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 162774485 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[(6S,8aS)-6-butoxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CCCCO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(O)C1NC(C)=O |
| InChI | InChI=1S/C19H27NO6/c1-3-4-10-23-19-15(20-12(2)21)16(22)17-14(25-19)11-24-18(26-17)13-8-6-5-7-9-13/h5-9,14-19,22H,3-4,10-11H2,1-2H3,(H,20,21)/t14?,15?,16?,17-,18?,19+/m1/s1 |
| InChIKey | HCMMZUOKBACCDP-JTRADQNDSA-N |
| XLogP | 1.51 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|