C25H37NO6 — CID 57343290
N-[(2R,4aR,6R,7R,8R,8aS)-6-[(E)-dec-2-enoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 57343290) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[(2R,4aR,6R,7R,8R,8aS)-6-[(E)-dec-2-enoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(2R,4aR,6R,7R,8R,8aS)-6-[(E)-dec-2-enoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 57343290 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | N-[(2R,4aR,6R,7R,8R,8aS)-6-[(E)-dec-2-enoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CCCCCCC/C=C/CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H37NO6/c1-3-4-5-6-7-8-9-13-16-29-25-21(26-18(2)27)22(28)23-20(31-25)17-30-24(32-23)19-14-11-10-12-15-19/h9-15,20-25,28H,3-8,16-17H2,1-2H3,(H,26,27)/b13-9+/t20-,21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | RCLAOQADLGKYFQ-FIKUBEEXSA-N |
| XLogP | 3.62 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|