C28H26O8S — CID 10885853
[(2R,4aR,6S,7R,8S,8aR)-6-methoxy-8-phenoxycarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 10885853) has the molecular formula C28H26O8S and a molecular weight of 522.58 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-8-phenoxycarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-8-phenoxycarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 10885853 |
| Molecular Formula | C28H26O8S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-8-phenoxycarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=S)Oc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26O8S/c1-30-27-24(34-25(29)18-11-5-2-6-12-18)23(36-28(37)32-20-15-9-4-10-16-20)22-21(33-27)17-31-26(35-22)19-13-7-3-8-14-19/h2-16,21-24,26-27H,17H2,1H3/t21-,22-,23+,24-,26-,27+/m1/s1 |
| InChIKey | BJTRIDHKWCWVEO-HZCCVSOPSA-N |
| XLogP | 4.45 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|