C18H22O6S4 — CID 177460746
O-[(4aR,6S,7R,8S,8aS)-6-methoxy-7-methylsulfanylcarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methylsulfanylmethanethioate (PubChem CID 177460746) has the molecular formula C18H22O6S4 and a molecular weight of 462.64 g/mol. Its IUPAC name is O-[(4aR,6S,7R,8S,8aS)-6-methoxy-7-methylsulfanylcarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(4aR,6S,7R,8S,8aS)-6-methoxy-7-methylsulfanylcarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 177460746 |
| Molecular Formula | C18H22O6S4 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | O-[(4aR,6S,7R,8S,8aS)-6-methoxy-7-methylsulfanylcarbothioyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methylsulfanylmethanethioate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OC(=S)SC)[C@H]1OC(=S)SC |
| InChI | InChI=1S/C18H22O6S4/c1-19-16-14(24-18(26)28-3)13(23-17(25)27-2)12-11(21-16)9-20-15(22-12)10-7-5-4-6-8-10/h4-8,11-16H,9H2,1-3H3/t11-,12+,13+,14-,15?,16+/m1/s1 |
| InChIKey | YQPXNPQGFIRGJL-FDYOVCMSSA-N |
| XLogP | 3.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|