C21H21NO9 — CID 132532524
[(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 132532524) has the molecular formula C21H21NO9 and a molecular weight of 431.40 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 132532524 |
| Molecular Formula | C21H21NO9 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccc([N+](=O)[O-])cc3)O[C@H]2[C@H](O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO9/c1-27-21-18(30-19(24)12-5-3-2-4-6-12)16(23)17-15(29-21)11-28-20(31-17)13-7-9-14(10-8-13)22(25)26/h2-10,15-18,20-21,23H,11H2,1H3/t15-,16+,17-,18-,20?,21+/m1/s1 |
| InChIKey | DZLGRLBYFPEDLR-QUJSNMKFSA-N |
| XLogP | 1.97 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|