C18H21NO10 — CID 102574234
[(4aR,6S,7R,8S,8aR)-7-acetyloxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102574234) has the molecular formula C18H21NO10 and a molecular weight of 411.36 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-7-acetyloxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-7-acetyloxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102574234 |
| Molecular Formula | C18H21NO10 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-7-acetyloxy-6-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccc([N+](=O)[O-])cc3)O[C@H]2[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H21NO10/c1-9(20)26-15-14-13(28-18(24-3)16(15)27-10(2)21)8-25-17(29-14)11-4-6-12(7-5-11)19(22)23/h4-7,13-18H,8H2,1-3H3/t13-,14-,15+,16-,17?,18+/m1/s1 |
| InChIKey | DZHBTKRHJSKQHX-AOXRCQJJSA-N |
| XLogP | 1.24 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|