C27H27F13O8 — CID 102081757
[(4aR,6S,7R,8S,8aS)-7-acetyloxy-6-methoxy-2-[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102081757) has the molecular formula C27H27F13O8 and a molecular weight of 726.48 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-7-acetyloxy-6-methoxy-2-[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-7-acetyloxy-6-methoxy-2-[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102081757 |
| Molecular Formula | C27H27F13O8 |
| Molecular Weight | 726.48 g/mol |
| Exact Mass | 726.15 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-7-acetyloxy-6-methoxy-2-[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)O[C@@H]2[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H27F13O8/c1-12(41)45-18-17-16(47-21(43-3)19(18)46-13(2)42)11-44-20(48-17)15-8-6-14(7-9-15)5-4-10-22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40/h6-9,16-21H,4-5,10-11H2,1-3H3/t16-,17+,18+,19-,20?,21+/m1/s1 |
| InChIKey | GWPPCRWLOLJBFN-BXLDVZOSSA-N |
| XLogP | 6.40 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|