C20H21NO8 — CID 10453780
(4aR,6S,7R,8R,8aS)-8-methoxy-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 10453780) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-8-methoxy-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6S,7R,8R,8aS)-8-methoxy-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 10453780 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-8-methoxy-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](Oc2ccc([N+](=O)[O-])cc2)O[C@@H]2COC(c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C20H21NO8/c1-25-18-16(22)20(27-14-9-7-13(8-10-14)21(23)24)28-15-11-26-19(29-17(15)18)12-5-3-2-4-6-12/h2-10,15-20,22H,11H2,1H3/t15-,16-,17+,18-,19?,20-/m1/s1 |
| InChIKey | BZFZETNKNWMJHW-PXNRFRIOSA-N |
| XLogP | 2.19 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|