C19H19NO7 — CID 125463265
(2S,4aS,6R,8S,8aS)-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 125463265) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is (2S,4aS,6R,8S,8aS)-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2S,4aS,6R,8S,8aS)-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 125463265 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2S,4aS,6R,8S,8aS)-6-(4-nitrophenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2C[C@H](O)[C@@H]3O[C@@H](c4ccccc4)OC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C19H19NO7/c21-15-10-17(25-14-8-6-13(7-9-14)20(22)23)26-16-11-24-19(27-18(15)16)12-4-2-1-3-5-12/h1-9,15-19,21H,10-11H2/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | PDDCYVLEUQIGRC-VMXHOPILSA-N |
| XLogP | 2.56 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|