C14H17NO8 — CID 139367029
(4aR,6S,7R,8S,8aR)-7-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol (PubChem CID 139367029) has the molecular formula C14H17NO8 and a molecular weight of 327.29 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aR)-7-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol.
| Compound Name | (4aR,6S,7R,8S,8aR)-7-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol |
|---|---|
| PubChem CID | 139367029 |
| Molecular Formula | C14H17NO8 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (4aR,6S,7R,8S,8aR)-7-methoxy-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H]2OC(c3ccc([N+](=O)[O-])cc3)OC[C@H]2O[C@@H]1O |
| InChI | InChI=1S/C14H17NO8/c1-20-12-10(16)11-9(22-13(12)17)6-21-14(23-11)7-2-4-8(5-3-7)15(18)19/h2-5,9-14,16-17H,6H2,1H3/t9-,10+,11+,12-,13+,14?/m1/s1 |
| InChIKey | DRBHJDHNXWVLLV-FFQWBXKWSA-N |
| XLogP | 0.10 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|