C11H13NO9 — CID 70120654
(4aS,7S,8S,8aR)-2-(5-nitrofuran-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol (PubChem CID 70120654) has the molecular formula C11H13NO9 and a molecular weight of 303.22 g/mol. Its IUPAC name is (4aS,7S,8S,8aR)-2-(5-nitrofuran-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol.
| Compound Name | (4aS,7S,8S,8aR)-2-(5-nitrofuran-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
|---|---|
| PubChem CID | 70120654 |
| Molecular Formula | C11H13NO9 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (4aS,7S,8S,8aR)-2-(5-nitrofuran-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
| SMILES | O=[N+]([O-])c1ccc(C2OC[C@@H]3OC(O)[C@@H](O)[C@H](O)[C@H]3O2)o1 |
| InChI | InChI=1S/C11H13NO9/c13-7-8(14)10(15)20-5-3-18-11(21-9(5)7)4-1-2-6(19-4)12(16)17/h1-2,5,7-11,13-15H,3H2/t5-,7-,8-,9-,10?,11?/m0/s1 |
| InChIKey | JAZUCJPQEYDFDL-XEARTXKYSA-N |
| XLogP | -0.96 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|