C20H21NO7S — CID 102479637
(4aR,6S,7R,8R,8aS)-6-(4-methylphenyl)sulfanyl-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 102479637) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-6-(4-methylphenyl)sulfanyl-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aS)-6-(4-methylphenyl)sulfanyl-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 102479637 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-6-(4-methylphenyl)sulfanyl-2-(4-nitrophenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H]3COC(c4ccc([N+](=O)[O-])cc4)O[C@H]3[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H21NO7S/c1-11-2-8-14(9-3-11)29-20-17(23)16(22)18-15(27-20)10-26-19(28-18)12-4-6-13(7-5-12)21(24)25/h2-9,15-20,22-23H,10H2,1H3/t15-,16-,17-,18-,19?,20+/m1/s1 |
| InChIKey | KVVNGYHTILFKFH-NPKOBNKKSA-N |
| XLogP | 2.56 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|