C15H22O5P2S — CID 58429856
6-(4-methylphenyl)sulfanyl-2-[methyl(phosphanyl)phosphanyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 58429856) has the molecular formula C15H22O5P2S and a molecular weight of 376.35 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfanyl-2-[methyl(phosphanyl)phosphanyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | 6-(4-methylphenyl)sulfanyl-2-[methyl(phosphanyl)phosphanyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 58429856 |
| Molecular Formula | C15H22O5P2S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-(4-methylphenyl)sulfanyl-2-[methyl(phosphanyl)phosphanyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | Cc1ccc(SC2OC3COC(P(C)P)OC3C(O)C2O)cc1 |
| InChI | InChI=1S/C15H22O5P2S/c1-8-3-5-9(6-4-8)23-14-12(17)11(16)13-10(19-14)7-18-15(20-13)22(2)21/h3-6,10-17H,7,21H2,1-2H3 |
| InChIKey | WTSQLVYXBZXXER-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|