C20H22O4S — CID 70671187
(6S,8R,8aS)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 70671187) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is (6S,8R,8aS)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8R,8aS)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 70671187 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (6S,8R,8aS)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C[C@@H]1C(O)[C@H](Sc2ccccc2)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C20H22O4S/c1-13-17(21)20(25-15-10-6-3-7-11-15)23-16-12-22-19(24-18(13)16)14-8-4-2-5-9-14/h2-11,13,16-21H,12H2,1H3/t13-,16?,17?,18+,19?,20+/m1/s1 |
| InChIKey | NUIRXVBKWCLTQE-LSZUAHPESA-N |
| XLogP | 3.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |