C20H21ClO4S — CID 155570806
(6R,8aR)-6-(3-chlorophenyl)sulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 155570806) has the molecular formula C20H21ClO4S and a molecular weight of 392.90 g/mol. Its IUPAC name is (6R,8aR)-6-(3-chlorophenyl)sulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6R,8aR)-6-(3-chlorophenyl)sulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 155570806 |
| Molecular Formula | C20H21ClO4S |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (6R,8aR)-6-(3-chlorophenyl)sulfanyl-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CC1C(O)[C@@H](Sc2cccc(Cl)c2)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C20H21ClO4S/c1-12-17(22)20(26-15-9-5-8-14(21)10-15)24-16-11-23-19(25-18(12)16)13-6-3-2-4-7-13/h2-10,12,16-20,22H,11H2,1H3/t12?,16?,17?,18-,19?,20-/m1/s1 |
| InChIKey | DALYZJRTLJUYKY-RNUHLPAMSA-N |
| XLogP | 4.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |