C19H19Br2NO4S — CID 155570929
(6R,8aR)-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 155570929) has the molecular formula C19H19Br2NO4S and a molecular weight of 517.24 g/mol. Its IUPAC name is (6R,8aR)-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6R,8aR)-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 155570929 |
| Molecular Formula | C19H19Br2NO4S |
| Molecular Weight | 517.24 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | (6R,8aR)-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CC1C(O)[C@@H](Sc2cc(Br)cnc2Br)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C19H19Br2NO4S/c1-10-15(23)19(27-14-7-12(20)8-22-17(14)21)25-13-9-24-18(26-16(10)13)11-5-3-2-4-6-11/h2-8,10,13,15-16,18-19,23H,9H2,1H3/t10?,13?,15?,16-,18?,19-/m1/s1 |
| InChIKey | IAEZRUMFINKLGP-IVGJPBFYSA-N |
| XLogP | 4.53 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|