C21H20BrN5O4S — CID 166587095
3-[[(6R,8S,8aR)-8-azido-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-bromo-2-isocyanopyridine (PubChem CID 166587095) has the molecular formula C21H20BrN5O4S and a molecular weight of 518.39 g/mol. Its IUPAC name is 3-[[(6R,8S,8aR)-8-azido-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-bromo-2-isocyanopyridine.
| Compound Name | 3-[[(6R,8S,8aR)-8-azido-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-bromo-2-isocyanopyridine |
|---|---|
| PubChem CID | 166587095 |
| Molecular Formula | C21H20BrN5O4S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 3-[[(6R,8S,8aR)-8-azido-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-bromo-2-isocyanopyridine |
| SMILES | [C-]#[N+]c1ncc(Br)cc1S[C@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](N=[N+]=[N-])C1OCC |
| InChI | InChI=1S/C21H20BrN5O4S/c1-3-28-18-16(26-27-23)17-14(11-29-20(31-17)12-7-5-4-6-8-12)30-21(18)32-15-9-13(22)10-25-19(15)24-2/h4-10,14,16-18,20-21H,3,11H2,1H3/t14?,16-,17-,18?,20?,21+/m0/s1 |
| InChIKey | KDGYQQSCSSPATQ-SDCDCCDFSA-N |
| XLogP | 5.41 |
| TPSA | 102.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|