C24H26ClN5O5S — CID 162699932
6-[3-[[(6R,8S,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-chloro-2-pyridinyl]-2-oxa-6-azaspiro[3.3]heptane (PubChem CID 162699932) has the molecular formula C24H26ClN5O5S and a molecular weight of 532.02 g/mol. Its IUPAC name is 6-[3-[[(6R,8S,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-chloro-2-pyridinyl]-2-oxa-6-azaspiro[3.3]heptane.
| Compound Name | 6-[3-[[(6R,8S,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-chloro-2-pyridinyl]-2-oxa-6-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 162699932 |
| Molecular Formula | C24H26ClN5O5S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 6-[3-[[(6R,8S,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-5-chloro-2-pyridinyl]-2-oxa-6-azaspiro[3.3]heptane |
| SMILES | COC1[C@@H](Sc2cc(Cl)cnc2N2CC3(COC3)C2)OC2COC(c3ccccc3)O[C@@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C24H26ClN5O5S/c1-31-20-18(28-29-26)19-16(9-33-22(35-19)14-5-3-2-4-6-14)34-23(20)36-17-7-15(25)8-27-21(17)30-10-24(11-30)12-32-13-24/h2-8,16,18-20,22-23H,9-13H2,1H3/t16?,18-,19-,20?,22?,23+/m0/s1 |
| InChIKey | LVGGBLSTDQDABR-NOEPSCTLSA-N |
| XLogP | 4.20 |
| TPSA | 111.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|