C27H21BrClF3N4O4S — CID 166951088
2-bromo-5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine (PubChem CID 166951088) has the molecular formula C27H21BrClF3N4O4S and a molecular weight of 669.91 g/mol. Its IUPAC name is 2-bromo-5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine.
| Compound Name | 2-bromo-5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 166951088 |
| Molecular Formula | C27H21BrClF3N4O4S |
| Molecular Weight | 669.91 g/mol |
| Exact Mass | 668.01 |
| IUPAC Name | 2-bromo-5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine |
| SMILES | COC1C(Sc2cc(Cl)cnc2Br)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C27H21BrClF3N4O4S/c1-37-24-22(36-11-18(34-35-36)14-7-16(30)21(32)17(31)8-14)23-19(12-38-26(40-23)13-5-3-2-4-6-13)39-27(24)41-20-9-15(29)10-33-25(20)28/h2-11,19,22-24,26-27H,12H2,1H3 |
| InChIKey | QFKCIWONGFGPPM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.91 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|