C24H22F3N3O6 — CID 142552200
methyl (4aR,6R,7R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 142552200) has the molecular formula C24H22F3N3O6 and a molecular weight of 505.45 g/mol. Its IUPAC name is methyl (4aR,6R,7R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | methyl (4aR,6R,7R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 142552200 |
| Molecular Formula | C24H22F3N3O6 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | methyl (4aR,6R,7R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC |
| InChI | InChI=1S/C24H22F3N3O6/c1-32-21-19(30-10-16(28-29-30)13-8-14(25)18(27)15(26)9-13)20-17(35-22(21)23(31)33-2)11-34-24(36-20)12-6-4-3-5-7-12/h3-10,17,19-22,24H,11H2,1-2H3/t17-,19+,20+,21-,22-,24?/m1/s1 |
| InChIKey | GOMIILBKBSOTMA-NNIAFLLDSA-N |
| XLogP | 2.97 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|