C32H29ClF3N3O7 — CID 163870254
methyl (2S)-2-[(8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-[(4-chlorophenyl)methoxy]acetate (PubChem CID 163870254) has the molecular formula C32H29ClF3N3O7 and a molecular weight of 660.05 g/mol. Its IUPAC name is methyl (2S)-2-[(8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-[(4-chlorophenyl)methoxy]acetate.
| Compound Name | methyl (2S)-2-[(8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-[(4-chlorophenyl)methoxy]acetate |
|---|---|
| PubChem CID | 163870254 |
| Molecular Formula | C32H29ClF3N3O7 |
| Molecular Weight | 660.05 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | methyl (2S)-2-[(8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-[(4-chlorophenyl)methoxy]acetate |
| SMILES | COC(=O)[C@@H](OCc1ccc(Cl)cc1)C1OC2COC(c3ccccc3)O[C@@H]2C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1OC |
| InChI | InChI=1S/C32H29ClF3N3O7/c1-41-28-26(39-14-23(37-38-39)19-12-21(34)25(36)22(35)13-19)27-24(16-44-32(46-27)18-6-4-3-5-7-18)45-29(28)30(31(40)42-2)43-15-17-8-10-20(33)11-9-17/h3-14,24,26-30,32H,15-16H2,1-2H3/t24?,26?,27-,28?,29?,30-,32?/m0/s1 |
| InChIKey | PKEIBNGHUWXLTQ-JFYDXHFXSA-N |
| XLogP | 5.21 |
| TPSA | 103.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|