C31H29F3N4O6 — CID 163428483
(2S)-2-[(7aR)-6-methoxy-2-phenyl-7-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-N-methyl-2-phenylmethoxyacetamide (PubChem CID 163428483) has the molecular formula C31H29F3N4O6 and a molecular weight of 610.59 g/mol. Its IUPAC name is (2S)-2-[(7aR)-6-methoxy-2-phenyl-7-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-N-methyl-2-phenylmethoxyacetamide.
| Compound Name | (2S)-2-[(7aR)-6-methoxy-2-phenyl-7-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-N-methyl-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 163428483 |
| Molecular Formula | C31H29F3N4O6 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | (2S)-2-[(7aR)-6-methoxy-2-phenyl-7-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-N-methyl-2-phenylmethoxyacetamide |
| SMILES | CNC(=O)[C@@H](OCc1ccccc1)C1OC2OC(c3ccccc3)O[C@@H]2C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1OC |
| InChI | InChI=1S/C31H29F3N4O6/c1-35-29(39)28(41-16-17-9-5-3-6-10-17)27-25(40-2)24(26-31(43-27)44-30(42-26)18-11-7-4-8-12-18)38-15-22(36-37-38)19-13-20(32)23(34)21(33)14-19/h3-15,24-28,30-31H,16H2,1-2H3,(H,35,39)/t24?,25?,26-,27?,28+,30?,31?/m1/s1 |
| InChIKey | AONJWMFWVDHYFQ-AENWFSHQSA-N |
| XLogP | 4.09 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|