C31H30F3N3O6 — CID 167424593
(2R)-2-[(6R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-phenylmethoxyethanol (PubChem CID 167424593) has the molecular formula C31H30F3N3O6 and a molecular weight of 597.59 g/mol. Its IUPAC name is (2R)-2-[(6R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-phenylmethoxyethanol.
| Compound Name | (2R)-2-[(6R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 167424593 |
| Molecular Formula | C31H30F3N3O6 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | (2R)-2-[(6R,8R,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2-phenylmethoxyethanol |
| SMILES | COC1[C@H]([C@@H](CO)OCc2ccccc2)OC2COC(c3ccccc3)O[C@@H]2[C@@H]1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C31H30F3N3O6/c1-39-30-27(37-14-23(35-36-37)20-12-21(32)26(34)22(33)13-20)28-25(17-41-31(43-28)19-10-6-3-7-11-19)42-29(30)24(15-38)40-16-18-8-4-2-5-9-18/h2-14,24-25,27-31,38H,15-17H2,1H3/t24-,25?,27+,28+,29+,30?,31?/m1/s1 |
| InChIKey | DXUXPCLPCCLOOB-RDQANCDJSA-N |
| XLogP | 4.38 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|