C32H28ClF3N4O5S — CID 166951213
azetidin-1-yl-[4-chloro-2-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]phenyl]methanone (PubChem CID 166951213) has the molecular formula C32H28ClF3N4O5S and a molecular weight of 673.11 g/mol. Its IUPAC name is azetidin-1-yl-[4-chloro-2-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]phenyl]methanone.
| Compound Name | azetidin-1-yl-[4-chloro-2-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 166951213 |
| Molecular Formula | C32H28ClF3N4O5S |
| Molecular Weight | 673.11 g/mol |
| Exact Mass | 672.14 |
| IUPAC Name | azetidin-1-yl-[4-chloro-2-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]phenyl]methanone |
| SMILES | COC1C(Sc2cc(Cl)ccc2C(=O)N2CCC2)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C32H28ClF3N4O5S/c1-42-29-27(40-15-23(37-38-40)18-12-21(34)26(36)22(35)13-18)28-24(16-43-31(45-28)17-6-3-2-4-7-17)44-32(29)46-25-14-19(33)8-9-20(25)30(41)39-10-5-11-39/h2-4,6-9,12-15,24,27-29,31-32H,5,10-11,16H2,1H3 |
| InChIKey | RJSGLASCNNKKAD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|