C31H27ClF3N5O5S — CID 166951287
azetidin-1-yl-[5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-2-pyridinyl]methanone (PubChem CID 166951287) has the molecular formula C31H27ClF3N5O5S and a molecular weight of 674.10 g/mol. Its IUPAC name is azetidin-1-yl-[5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-2-pyridinyl]methanone.
| Compound Name | azetidin-1-yl-[5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 166951287 |
| Molecular Formula | C31H27ClF3N5O5S |
| Molecular Weight | 674.10 g/mol |
| Exact Mass | 673.14 |
| IUPAC Name | azetidin-1-yl-[5-chloro-3-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-2-pyridinyl]methanone |
| SMILES | COC1C(Sc2cc(Cl)cnc2C(=O)N2CCC2)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C31H27ClF3N5O5S/c1-42-28-26(40-14-21(37-38-40)17-10-19(33)24(35)20(34)11-17)27-22(15-43-30(45-27)16-6-3-2-4-7-16)44-31(28)46-23-12-18(32)13-36-25(23)29(41)39-8-5-9-39/h2-4,6-7,10-14,22,26-28,30-31H,5,8-9,15H2,1H3 |
| InChIKey | FIXHAPQEQOPMCY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.10 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|