C29H22ClF3N4O4S — CID 166951119
2-[[(6R,7S,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-chlorobenzonitrile (PubChem CID 166951119) has the molecular formula C29H22ClF3N4O4S and a molecular weight of 615.03 g/mol. Its IUPAC name is 2-[[(6R,7S,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-chlorobenzonitrile.
| Compound Name | 2-[[(6R,7S,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 166951119 |
| Molecular Formula | C29H22ClF3N4O4S |
| Molecular Weight | 615.03 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | 2-[[(6R,7S,8aR)-7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-chlorobenzonitrile |
| SMILES | CO[C@H]1C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]2OC(c3ccccc3)OCC2O[C@@H]1Sc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C29H22ClF3N4O4S/c1-38-27-25(37-13-21(35-36-37)17-9-19(31)24(33)20(32)10-17)26-22(14-39-28(41-26)15-5-3-2-4-6-15)40-29(27)42-23-11-18(30)8-7-16(23)12-34/h2-11,13,22,25-29H,14H2,1H3/t22?,25?,26-,27-,28?,29+/m0/s1 |
| InChIKey | HXWNKBLBKGKBFG-YWYUTOCBSA-N |
| XLogP | 6.07 |
| TPSA | 91.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.03 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|