C27H22ClF3N4O4S — CID 166951218
3-chloro-5-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine (PubChem CID 166951218) has the molecular formula C27H22ClF3N4O4S and a molecular weight of 591.01 g/mol. Its IUPAC name is 3-chloro-5-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine.
| Compound Name | 3-chloro-5-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 166951218 |
| Molecular Formula | C27H22ClF3N4O4S |
| Molecular Weight | 591.01 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 3-chloro-5-[[7-methoxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]pyridine |
| SMILES | COC1C(Sc2cncc(Cl)c2)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C27H22ClF3N4O4S/c1-36-25-23(35-12-20(33-34-35)15-7-18(29)22(31)19(30)8-15)24-21(13-37-26(39-24)14-5-3-2-4-6-14)38-27(25)40-17-9-16(28)10-32-11-17/h2-12,21,23-27H,13H2,1H3 |
| InChIKey | SVAMOHQZSQIQSO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|