C28H22Cl3F2N3O4S — CID 166047614
1-[(6R,7S,8aR)-6-(3,4-dichlorophenyl)sulfanyl-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(4-chloro-3,5-difluorophenyl)triazole (PubChem CID 166047614) has the molecular formula C28H22Cl3F2N3O4S and a molecular weight of 640.92 g/mol. Its IUPAC name is 1-[(6R,7S,8aR)-6-(3,4-dichlorophenyl)sulfanyl-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(4-chloro-3,5-difluorophenyl)triazole.
| Compound Name | 1-[(6R,7S,8aR)-6-(3,4-dichlorophenyl)sulfanyl-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(4-chloro-3,5-difluorophenyl)triazole |
|---|---|
| PubChem CID | 166047614 |
| Molecular Formula | C28H22Cl3F2N3O4S |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | 1-[(6R,7S,8aR)-6-(3,4-dichlorophenyl)sulfanyl-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(4-chloro-3,5-difluorophenyl)triazole |
| SMILES | CO[C@H]1C(n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@H]2OC(c3ccccc3)OCC2O[C@@H]1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H22Cl3F2N3O4S/c1-37-26-24(36-12-21(34-35-36)15-9-19(32)23(31)20(33)10-15)25-22(13-38-27(40-25)14-5-3-2-4-6-14)39-28(26)41-16-7-8-17(29)18(30)11-16/h2-12,22,24-28H,13H2,1H3/t22?,24?,25-,26-,27?,28+/m0/s1 |
| InChIKey | XOSJHYJWYMQVGH-QTOSHHIDSA-N |
| XLogP | 7.37 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|