C23H20ClF2N3O4 — CID 155201759
1-[(4aR,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]ethanone (PubChem CID 155201759) has the molecular formula C23H20ClF2N3O4 and a molecular weight of 475.88 g/mol. Its IUPAC name is 1-[(4aR,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]ethanone.
| Compound Name | 1-[(4aR,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]ethanone |
|---|---|
| PubChem CID | 155201759 |
| Molecular Formula | C23H20ClF2N3O4 |
| Molecular Weight | 475.88 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-[(4aR,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]ethanone |
| SMILES | CC(=O)C1C[C@@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@H]2OC(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C23H20ClF2N3O4/c1-12(30)19-9-18(22-20(32-19)11-31-23(33-22)13-5-3-2-4-6-13)29-10-17(27-28-29)14-7-15(25)21(24)16(26)8-14/h2-8,10,18-20,22-23H,9,11H2,1H3/t18-,19?,20-,22-,23?/m1/s1 |
| InChIKey | FRKMGXRYMBNGRX-STXPDUOUSA-N |
| XLogP | 4.28 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.88 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|