C30H23Cl2F3N6O3 — CID 142561547
1-(2,3-dichlorophenyl)-3-methyl-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole (PubChem CID 142561547) has the molecular formula C30H23Cl2F3N6O3 and a molecular weight of 643.45 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-methyl-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole.
| Compound Name | 1-(2,3-dichlorophenyl)-3-methyl-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 142561547 |
| Molecular Formula | C30H23Cl2F3N6O3 |
| Molecular Weight | 643.45 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-methyl-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole |
| SMILES | Cc1nc(C2CC(n3cc(-c4cc(F)c(F)c(F)c4)nn3)C3OC(c4ccccc4)OCC3O2)n(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C30H23Cl2F3N6O3/c1-15-36-29(41(38-15)22-9-5-8-18(31)26(22)32)24-12-23(28-25(43-24)14-42-30(44-28)16-6-3-2-4-7-16)40-13-21(37-39-40)17-10-19(33)27(35)20(34)11-17/h2-11,13,23-25,28,30H,12,14H2,1H3 |
| InChIKey | ITHBOOMFZCTNHX-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|