C30H23Cl2F3N6O4 — CID 138516864
6-[2-(2,5-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 138516864) has the molecular formula C30H23Cl2F3N6O4 and a molecular weight of 659.45 g/mol. Its IUPAC name is 6-[2-(2,5-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | 6-[2-(2,5-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 138516864 |
| Molecular Formula | C30H23Cl2F3N6O4 |
| Molecular Weight | 659.45 g/mol |
| Exact Mass | 658.11 |
| IUPAC Name | 6-[2-(2,5-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | Cc1nc(C2OC3COC(c4ccccc4)OC3C(n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)n(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C30H23Cl2F3N6O4/c1-14-36-29(41(38-14)22-11-17(31)7-8-18(22)32)28-26(42)25(27-23(44-28)13-43-30(45-27)15-5-3-2-4-6-15)40-12-21(37-39-40)16-9-19(33)24(35)20(34)10-16/h2-12,23,25-28,30,42H,13H2,1H3 |
| InChIKey | NCFQZGZZCCZDAL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|