C24H22F3N3O6 — CID 155005702
methyl 2-[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate (PubChem CID 155005702) has the molecular formula C24H22F3N3O6 and a molecular weight of 505.45 g/mol. Its IUPAC name is methyl 2-[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate.
| Compound Name | methyl 2-[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate |
|---|---|
| PubChem CID | 155005702 |
| Molecular Formula | C24H22F3N3O6 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | methyl 2-[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate |
| SMILES | COC(=O)CC1OC2COC(c3ccccc3)OC2C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C24H22F3N3O6/c1-33-19(31)9-17-22(32)21(23-18(35-17)11-34-24(36-23)12-5-3-2-4-6-12)30-10-16(28-29-30)13-7-14(25)20(27)15(26)8-13/h2-8,10,17-18,21-24,32H,9,11H2,1H3 |
| InChIKey | NRSQNTJSPBLZAC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|