C30H23F3N4O5S — CID 155201751
(2S,4aR,6R,7R,8R,8aR)-N-(1-benzothiophen-6-yl)-7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide (PubChem CID 155201751) has the molecular formula C30H23F3N4O5S and a molecular weight of 608.60 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8R,8aR)-N-(1-benzothiophen-6-yl)-7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide.
| Compound Name | (2S,4aR,6R,7R,8R,8aR)-N-(1-benzothiophen-6-yl)-7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
|---|---|
| PubChem CID | 155201751 |
| Molecular Formula | C30H23F3N4O5S |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | (2S,4aR,6R,7R,8R,8aR)-N-(1-benzothiophen-6-yl)-7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
| SMILES | O=C(Nc1ccc2ccsc2c1)[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C30H23F3N4O5S/c31-19-10-17(11-20(32)24(19)33)21-13-37(36-35-21)25-26(38)28(29(39)34-18-7-6-15-8-9-43-23(15)12-18)41-22-14-40-30(42-27(22)25)16-4-2-1-3-5-16/h1-13,22,25-28,30,38H,14H2,(H,34,39)/t22-,25-,26-,27+,28-,30+/m1/s1 |
| InChIKey | HUMZHGPBTNIJIL-LEAYDWISSA-N |
| XLogP | 5.00 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|