C23H18F3N3O5 — CID 138505866
methyl (4aR,8R,8aR)-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 138505866) has the molecular formula C23H18F3N3O5 and a molecular weight of 473.41 g/mol. Its IUPAC name is methyl (4aR,8R,8aR)-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | methyl (4aR,8R,8aR)-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 138505866 |
| Molecular Formula | C23H18F3N3O5 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl (4aR,8R,8aR)-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]2OC(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C23H18F3N3O5/c1-31-22(30)18-9-17(21-19(33-18)11-32-23(34-21)12-5-3-2-4-6-12)29-10-16(27-28-29)13-7-14(24)20(26)15(25)8-13/h2-10,17,19,21,23H,11H2,1H3/t17-,19-,21-,23?/m1/s1 |
| InChIKey | XGWNRCJXIRKJTP-HUTUGTLRSA-N |
| XLogP | 3.47 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|