C24H25FN4O5 — CID 175841014
8-[4-(3-fluorophenyl)triazol-1-yl]-7-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide (PubChem CID 175841014) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is 8-[4-(3-fluorophenyl)triazol-1-yl]-7-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide.
| Compound Name | 8-[4-(3-fluorophenyl)triazol-1-yl]-7-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
|---|---|
| PubChem CID | 175841014 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 8-[4-(3-fluorophenyl)triazol-1-yl]-7-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
| SMILES | CNC(=O)C1OC2COC(c3ccccc3)OC2C(n2cc(-c3cccc(F)c3)nn2)C1OC |
| InChI | InChI=1S/C24H25FN4O5/c1-26-23(30)22-21(31-2)19(29-12-17(27-28-29)15-9-6-10-16(25)11-15)20-18(33-22)13-32-24(34-20)14-7-4-3-5-8-14/h3-12,18-22,24H,13H2,1-2H3,(H,26,30) |
| InChIKey | CUIYQQGUDWOOEL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |