C34H34ClF3N4O5 — CID 177097909
N-(2-tert-butyl-5-chlorophenyl)-7-methoxy-N-methyl-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide (PubChem CID 177097909) has the molecular formula C34H34ClF3N4O5 and a molecular weight of 671.12 g/mol. Its IUPAC name is N-(2-tert-butyl-5-chlorophenyl)-7-methoxy-N-methyl-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide.
| Compound Name | N-(2-tert-butyl-5-chlorophenyl)-7-methoxy-N-methyl-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
|---|---|
| PubChem CID | 177097909 |
| Molecular Formula | C34H34ClF3N4O5 |
| Molecular Weight | 671.12 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | N-(2-tert-butyl-5-chlorophenyl)-7-methoxy-N-methyl-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
| SMILES | COC1C(C(=O)N(C)c2cc(Cl)ccc2C(C)(C)C)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C34H34ClF3N4O5/c1-34(2,3)21-12-11-20(35)15-25(21)41(4)32(43)31-30(44-5)28(29-26(46-31)17-45-33(47-29)18-9-7-6-8-10-18)42-16-24(39-40-42)19-13-22(36)27(38)23(37)14-19/h6-16,26,28-31,33H,17H2,1-5H3 |
| InChIKey | OPNSVUCQIOJGEG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.12 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|