C30H26ClF3N4O5S — CID 166881694
4-chloro-2-[[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-N,N-dimethylbenzamide (PubChem CID 166881694) has the molecular formula C30H26ClF3N4O5S and a molecular weight of 647.08 g/mol. Its IUPAC name is 4-chloro-2-[[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-2-[[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166881694 |
| Molecular Formula | C30H26ClF3N4O5S |
| Molecular Weight | 647.08 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 4-chloro-2-[[7-hydroxy-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1SC1OC2COC(c3ccccc3)OC2C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C30H26ClF3N4O5S/c1-37(2)28(40)18-9-8-17(31)12-23(18)44-30-26(39)25(27-22(42-30)14-41-29(43-27)15-6-4-3-5-7-15)38-13-21(35-36-38)16-10-19(32)24(34)20(33)11-16/h3-13,22,25-27,29-30,39H,14H2,1-2H3 |
| InChIKey | NXNVNOCCLPAUMW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|