C26H20BrF3N4O4S — CID 166881730
6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 166881730) has the molecular formula C26H20BrF3N4O4S and a molecular weight of 621.44 g/mol. Its IUPAC name is 6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | 6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 166881730 |
| Molecular Formula | C26H20BrF3N4O4S |
| Molecular Weight | 621.44 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | 6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | OC1C(Sc2cncc(Br)c2)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C26H20BrF3N4O4S/c27-15-8-16(10-31-9-15)39-26-23(35)22(24-20(37-26)12-36-25(38-24)13-4-2-1-3-5-13)34-11-19(32-33-34)14-6-17(28)21(30)18(29)7-14/h1-11,20,22-26,35H,12H2 |
| InChIKey | CRNYBBVTIVQKRX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|