C35H39BrF3N4O8PS — CID 166881701
[6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxymethyl ditert-butyl phosphate (PubChem CID 166881701) has the molecular formula C35H39BrF3N4O8PS and a molecular weight of 843.66 g/mol. Its IUPAC name is [6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxymethyl ditert-butyl phosphate.
| Compound Name | [6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxymethyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 166881701 |
| Molecular Formula | C35H39BrF3N4O8PS |
| Molecular Weight | 843.66 g/mol |
| Exact Mass | 842.14 |
| IUPAC Name | [6-[(5-bromo-3-pyridinyl)sulfanyl]-2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxymethyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCOC1C(Sc2cncc(Br)c2)OC2COC(c3ccccc3)OC2C1n1cc(-c2cc(F)c(F)c(F)c2)nn1)OC(C)(C)C |
| InChI | InChI=1S/C35H39BrF3N4O8PS/c1-34(2,3)50-52(44,51-35(4,5)6)47-19-46-31-29(43-17-26(41-42-43)21-12-24(37)28(39)25(38)13-21)30-27(18-45-32(49-30)20-10-8-7-9-11-20)48-33(31)53-23-14-22(36)15-40-16-23/h7-17,27,29-33H,18-19H2,1-6H3 |
| InChIKey | MCZOSIJMVBJHAS-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|