C23H20ClF2N3O6 — CID 156682871
methyl (4aR,6R,7R,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 156682871) has the molecular formula C23H20ClF2N3O6 and a molecular weight of 507.88 g/mol. Its IUPAC name is methyl (4aR,6R,7R,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | methyl (4aR,6R,7R,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 156682871 |
| Molecular Formula | C23H20ClF2N3O6 |
| Molecular Weight | 507.88 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | methyl (4aR,6R,7R,8R,8aR)-8-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C23H20ClF2N3O6/c1-32-22(31)21-19(30)18(20-16(34-21)10-33-23(35-20)11-5-3-2-4-6-11)29-9-15(27-28-29)12-7-13(25)17(24)14(26)8-12/h2-9,16,18-21,23,30H,10H2,1H3/t16-,18-,19-,20+,21-,23?/m1/s1 |
| InChIKey | QIHNFJPUVGJLLH-IEHCHFFWSA-N |
| XLogP | 2.83 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|