C17H16F3N3O6 — CID 142552211
(2S,4aR,6R,7R,8R,8aR)-7-hydroxy-2-methyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid (PubChem CID 142552211) has the molecular formula C17H16F3N3O6 and a molecular weight of 415.32 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8R,8aR)-7-hydroxy-2-methyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid.
| Compound Name | (2S,4aR,6R,7R,8R,8aR)-7-hydroxy-2-methyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 142552211 |
| Molecular Formula | C17H16F3N3O6 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2S,4aR,6R,7R,8R,8aR)-7-hydroxy-2-methyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
| SMILES | C[C@H]1OC[C@H]2O[C@@H](C(=O)O)[C@H](O)[C@@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O1 |
| InChI | InChI=1S/C17H16F3N3O6/c1-6-27-5-11-15(28-6)13(14(24)16(29-11)17(25)26)23-4-10(21-22-23)7-2-8(18)12(20)9(19)3-7/h2-4,6,11,13-16,24H,5H2,1H3,(H,25,26)/t6-,11+,13+,14+,15-,16+/m0/s1 |
| InChIKey | UOKWDZAWZVZIHT-VEXRZOFGSA-N |
| XLogP | 0.88 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|