C21H26F3N3O6Si — CID 156637332
(4aR,6R,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid (PubChem CID 156637332) has the molecular formula C21H26F3N3O6Si and a molecular weight of 501.53 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid.
| Compound Name | (4aR,6R,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 156637332 |
| Molecular Formula | C21H26F3N3O6Si |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-2,2-dimethyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
| SMILES | CC1(C)OC[C@H]2O[C@@H](C(=O)O)[C@H](O[Si](C)(C)C)[C@@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O1 |
| InChI | InChI=1S/C21H26F3N3O6Si/c1-21(2)30-9-14-17(32-21)16(18(33-34(3,4)5)19(31-14)20(28)29)27-8-13(25-26-27)10-6-11(22)15(24)12(23)7-10/h6-8,14,16-19H,9H2,1-5H3,(H,28,29)/t14-,16+,17+,18-,19-/m1/s1 |
| InChIKey | WCBNDKHDUBOXPH-QFACEVIFSA-N |
| XLogP | 3.13 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|